ChemNet > CAS > 2455-24-5 Tetrahydrofurfuryl methacrylate
2455-24-5 Tetrahydrofurfuryl methacrylate
| product Name |
Tetrahydrofurfuryl methacrylate |
| CAS No |
2455-24-5 |
| Synonyms |
Methacrylic acid tetrahydrofurfuryl ester; tetrahydrofuran-2-ylmethyl 2-methylprop-2-enoate |
| Molecular Formula |
C9H14O3 |
| Molecular Weight |
170.2057 |
| InChI |
InChI=1/C9H14O3/c1-7(2)9(10)12-6-8-4-3-5-11-8/h8H,1,3-6H2,2H3 |
| EINECS |
219-529-5 |
| Molecular Structure |
|
| Density |
1.03g/cm3 |
| Boiling point |
265°C at 760 mmHg |
| Refractive index |
1.452 |
| Flash point |
105.6°C |
| Vapour Pressur |
0.0094mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R10:Flammable.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S36:;
|
|
