24623-20-9 6-methyl-1-indanone
product Name |
6-methyl-1-indanone |
CAS No |
24623-20-9 |
Synonyms |
6-methyl-2,3-dihydro-1H-inden-1-one |
Molecular Formula |
C10H10O |
Molecular Weight |
146.1858 |
InChI |
InChI=1/C10H10O/c1-7-2-3-8-4-5-10(11)9(8)6-7/h2-3,6H,4-5H2,1H3 |
Molecular Structure |
|
Density |
1.113g/cm3 |
Melting point |
60-62℃ |
Boiling point |
265.1°C at 760 mmHg |
Refractive index |
1.574 |
Flash point |
109.9°C |
Vapour Pressur |
0.00935mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|