ChemNet > CAS > 24673-56-1 3-Methylbenzofuran-2-carboxylic acid
24673-56-1 3-Methylbenzofuran-2-carboxylic acid
| product Name |
3-Methylbenzofuran-2-carboxylic acid |
| CAS No |
24673-56-1 |
| Synonyms |
3-Methylbenzo[b]furan-2-carboxylic acid; 3-methyl-1-benzofuran-2-carboxylic acid; 3-methyl-1-benzofuran-2-carboxylate; 3-Methyl-benzofuran-2-carboxylic acid |
| Molecular Formula |
C10H7O3 |
| Molecular Weight |
175.1613 |
| InChI |
InChI=1/C10H8O3/c1-6-7-4-2-3-5-8(7)13-9(6)10(11)12/h2-5H,1H3,(H,11,12)/p-1 |
| Molecular Structure |
|
| Melting point |
192-197℃ |
| Boiling point |
328.7°C at 760 mmHg |
| Flash point |
152.6°C |
| Vapour Pressur |
7.53E-05mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S24/25:;
|
| MSDS |
Material Safety Data Sheet
|
|
