ChemNet > CAS > 24686-78-0 N-Benzoyl-4-piperidone
24686-78-0 N-Benzoyl-4-piperidone
product Name |
N-Benzoyl-4-piperidone |
Synonyms |
1-benzoylpiperidin-4-one |
Molecular Formula |
C12H13NO2 |
Molecular Weight |
203.2371 |
InChI |
InChI=1/C12H13NO2/c14-11-6-8-13(9-7-11)12(15)10-4-2-1-3-5-10/h1-5H,6-9H2 |
CAS Registry Number |
24686-78-0 |
EINECS |
246-407-9 |
Molecular Structure |
|
Density |
1.188g/cm3 |
Melting point |
56-59℃ |
Boiling point |
403.8°C at 760 mmHg |
Refractive index |
1.573 |
Flash point |
175.7°C |
Vapour Pressur |
9.9E-07mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|