ChemNet > CAS > 246862-63-5 2-(4-chloro-3,5-dimethylphenoxy)-3-nitropyridine
246862-63-5 2-(4-chloro-3,5-dimethylphenoxy)-3-nitropyridine
| product Name |
2-(4-chloro-3,5-dimethylphenoxy)-3-nitropyridine |
| CAS No |
246862-63-5 |
| Molecular Formula |
C13H11ClN2O3 |
| Molecular Weight |
278.691 |
| InChI |
InChI=1/C13H11ClN2O3/c1-8-6-10(7-9(2)12(8)14)19-13-11(16(17)18)4-3-5-15-13/h3-7H,1-2H3 |
| Molecular Structure |
|
| Density |
1.329g/cm3 |
| Melting point |
80℃ |
| Boiling point |
382.6°C at 760 mmHg |
| Refractive index |
1.601 |
| Flash point |
185.2°C |
| Vapour Pressur |
1.03E-05mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
