ChemNet > CAS > 24758-49-4 4-Morpholinobenzophenone
24758-49-4 4-Morpholinobenzophenone
| product Name |
4-Morpholinobenzophenone |
| CAS No |
24758-49-4 |
| Synonyms |
NSC 111168; [4-(morpholin-4-yl)phenyl](phenyl)methanone |
| Molecular Formula |
C17H17NO2 |
| Molecular Weight |
267.3224 |
| InChI |
InChI=1/C17H17NO2/c19-17(14-4-2-1-3-5-14)15-6-8-16(9-7-15)18-10-12-20-13-11-18/h1-9H,10-13H2 |
| EINECS |
246-447-7 |
| Molecular Structure |
|
| Density |
1.157g/cm3 |
| Melting point |
142-145℃ |
| Boiling point |
450.5°C at 760 mmHg |
| Refractive index |
1.589 |
| Flash point |
226.3°C |
| Vapour Pressur |
2.62E-08mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
