ChemNet > CAS > 24932-48-7 4,5-Dibromo-o-xylene
24932-48-7 4,5-Dibromo-o-xylene
| product Name |
4,5-Dibromo-o-xylene |
| CAS No |
24932-48-7 |
| Synonyms |
1,2-Dibromo-4,5-dimethylbenzene |
| Molecular Formula |
C8H8Br2 |
| Molecular Weight |
263.9571 |
| InChI |
InChI=1/C8H8Br2/c1-5-3-7(9)8(10)4-6(5)2/h3-4H,1-2H3 |
| Molecular Structure |
|
| Density |
1.71g/cm3 |
| Boiling point |
279.1°C at 760 mmHg |
| Refractive index |
1.578 |
| Flash point |
138.7°C |
| Vapour Pressur |
0.00694mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
