ChemNet > CAS > 24936-44-5 Poly(4-methoxystyrene)
24936-44-5 Poly(4-methoxystyrene)
| product Name |
Poly(4-methoxystyrene) |
| CAS No |
24936-44-5 |
| Synonyms |
4-Methoxystyrene Resin; 1-ethenyl-4-methoxybenzene |
| Molecular Formula |
C9H10O |
| Molecular Weight |
134.1751 |
| InChI |
InChI=1/C9H10O/c1-3-8-4-6-9(10-2)7-5-8/h3-7H,1H2,2H3 |
| EINECS |
211-298-9 |
| Molecular Structure |
|
| Density |
0.962g/cm3 |
| Boiling point |
220.7°C at 760 mmHg |
| Refractive index |
1.541 |
| Flash point |
77.7°C |
| Vapour Pressur |
0.165mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
