ChemNet > CAS > 24985-85-1 Ethyl 5-hydroxyindole-2-carboxylate
24985-85-1 Ethyl 5-hydroxyindole-2-carboxylate
| product Name |
Ethyl 5-hydroxyindole-2-carboxylate |
| CAS No |
24985-85-1 |
| Synonyms |
5-Hydroxyindole-2-carboxylic acid ethyl ester; ethyl 5-hydroxy-1H-indole-2-carboxylate; (1-benzylpiperidin-3-yl)methanol |
| Molecular Formula |
C13H19NO |
| Molecular Weight |
205.2961 |
| InChI |
InChI=1/C13H19NO/c15-11-13-7-4-8-14(10-13)9-12-5-2-1-3-6-12/h1-3,5-6,13,15H,4,7-11H2 |
| EINECS |
246-554-9 |
| Molecular Structure |
|
| Density |
1.056g/cm3 |
| Boiling point |
294.068°C at 760 mmHg |
| Refractive index |
1.551 |
| Flash point |
123.378°C |
| Vapour Pressur |
0.001mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
