ChemNet > CAS > 25038-87-3 Poly(vinyl methyl ketone)
25038-87-3 Poly(vinyl methyl ketone)
| product Name |
Poly(vinyl methyl ketone) |
| CAS No |
25038-87-3 |
| Synonyms |
Poly(Methyl vinyl ketone); but-3-en-2-one |
| Molecular Formula |
C4H6O |
| Molecular Weight |
70.0898 |
| InChI |
InChI=1/C4H6O/c1-3-4(2)5/h3H,1H2,2H3 |
| EINECS |
201-160-6 |
| Molecular Structure |
|
| Density |
0.807g/cm3 |
| Boiling point |
81.4°C at 760 mmHg |
| Refractive index |
1.384 |
| Vapour Pressur |
82.1mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
