ChemNet > CAS > 25109-28-8 1-Bromo-4-cyclohexylbenzene
25109-28-8 1-Bromo-4-cyclohexylbenzene
| product Name |
1-Bromo-4-cyclohexylbenzene |
| CAS No |
25109-28-8 |
| Synonyms |
4-Cyclohexylbromobenzene |
| Molecular Formula |
C12H15Br |
| Molecular Weight |
239.1515 |
| InChI |
InChI=1/C12H15Br/c13-12-8-6-11(7-9-12)10-4-2-1-3-5-10/h6-10H,1-5H2 |
| EINECS |
246-623-3 |
| Molecular Structure |
|
| Density |
1.28g/cm3 |
| Boiling point |
290.2°C at 760 mmHg |
| Refractive index |
1.553 |
| Flash point |
127.9°C |
| Vapour Pressur |
0.00366mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
