ChemNet > CAS > 25115-74-6 4-Cyano-4-phenylcyclohexanone
25115-74-6 4-Cyano-4-phenylcyclohexanone
| product Name |
4-Cyano-4-phenylcyclohexanone |
| CAS No |
25115-74-6 |
| Synonyms |
4-oxo-1-phenylcyclohexanenitrile; 4-oxo-1-phenylcyclohexanecarbonitrile |
| Molecular Formula |
C13H13NO |
| Molecular Weight |
199.2484 |
| InChI |
InChI=1/C13H13NO/c14-10-13(8-6-12(15)7-9-13)11-4-2-1-3-5-11/h1-5H,6-9H2 |
| EINECS |
246-631-7 |
| Molecular Structure |
|
| Density |
1.12g/cm3 |
| Melting point |
114-119℃ |
| Boiling point |
378.6°C at 760 mmHg |
| Refractive index |
1.557 |
| Flash point |
182.8°C |
| Vapour Pressur |
6.22E-06mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
