ChemNet > CAS > 25117-74-2 4-Ethoxybenzonitrile
25117-74-2 4-Ethoxybenzonitrile
| product Name |
4-Ethoxybenzonitrile |
| CAS No |
25117-74-2 |
| Synonyms |
4-Ethoxybenzoic acid nitrile; p-Ethoxybenzonitrile |
| Molecular Formula |
C9H9NO |
| Molecular Weight |
147.1739 |
| InChI |
InChI=1/C9H9NO/c1-2-11-9-5-3-8(7-10)4-6-9/h3-6H,2H2,1H3 |
| Molecular Structure |
|
| Density |
1.05g/cm3 |
| Boiling point |
258°C at 760 mmHg |
| Refractive index |
1.52 |
| Flash point |
110.9°C |
| Vapour Pressur |
0.0141mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Safety Description |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|
