ChemNet > CAS > 25153-40-6 Methyl vinyl ether/maleic acid copolymer
25153-40-6 Methyl vinyl ether/maleic acid copolymer
| product Name |
Methyl vinyl ether/maleic acid copolymer |
| CAS No |
25153-40-6 |
| Synonyms |
Poly(methyl vinyl ether-alt-maleic acid); methoxyethene-(2Z)-but-2-enedioic acid (1:1); poly(methyl vinyl ether/maleic acid)copolymer; Poly( methyl vinyl ether/maleic acid）copolymer (PP series) |
| Molecular Formula |
C7H10O5 |
| Molecular Weight |
174.1513 |
| InChI |
InChI=1/C4H4O4.C3H6O/c5-3(6)1-2-4(7)8;1-3-4-2/h1-2H,(H,5,6)(H,7,8);3H,1H2,2H3/b2-1-; |
| Molecular Structure |
|
| Boiling point |
355.5°C at 760 mmHg |
| Flash point |
183°C |
| Vapour Pressur |
5.19E-06mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
