ChemNet > CAS > 25154-52-3 4-(2,6-Dimethylheptyl)phenol(O and P)
25154-52-3 4-(2,6-Dimethylheptyl)phenol(O and P)
| product Name |
4-(2,6-Dimethylheptyl)phenol(O and P) |
| CAS No |
25154-52-3;1300-16-9 |
| Synonyms |
2,6-dimethyl-4-heptylphenol,(oandp); hydroxylno.253; monononylphenol; n-nonylphenol; nonyl; nonyl-pheno; nonylphenol(isomermixture); nonylphenol; Nonyl phenol; potassium 2-nonylphenolate; strontium bis(2-nonylphenolate); sodium 2-nonylphenolate; 4-(2,6-dimethylheptyl)phenol; 4-(1,3,5-trimethylhexyl)phenol |
| Molecular Formula |
C15H24O |
| Molecular Weight |
220.3505 |
| InChI |
InChI=1/C15H24O/c1-11(2)9-12(3)10-13(4)14-5-7-15(16)8-6-14/h5-8,11-13,16H,9-10H2,1-4H3 |
| EINECS |
246-672-0 |
| Molecular Structure |
|
| Density |
0.926g/cm3 |
| Melting point |
-8℃ |
| Boiling point |
306.7°C at 760 mmHg |
| Refractive index |
1.5 |
| Flash point |
156.2°C |
| Water solubility |
6 mg l-1 |
| Vapour Pressur |
0.000418mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|
