ChemNet > CAS > 25173-72-2 3-(3,4,5-Trimethoxyphenyl)propionic acid
25173-72-2 3-(3,4,5-Trimethoxyphenyl)propionic acid
| product Name |
3-(3,4,5-Trimethoxyphenyl)propionic acid |
| CAS No |
25173-72-2 |
| Synonyms |
3,4,5-Trimethoxyhydrocinnamic acid; 3-(3,4,5-trimethoxyphenyl)propanoic acid; 3-(3,4,5-trimethoxyphenyl)propanoate |
| Molecular Formula |
C12H15O5 |
| Molecular Weight |
239.245 |
| InChI |
InChI=1/C12H16O5/c1-15-9-6-8(4-5-11(13)14)7-10(16-2)12(9)17-3/h6-7H,4-5H2,1-3H3,(H,13,14)/p-1 |
| EINECS |
246-706-4 |
| Molecular Structure |
|
| Melting point |
100-105℃ |
| Boiling point |
373.3°C at 760 mmHg |
| Flash point |
139.9°C |
| Vapour Pressur |
3.1E-06mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
