ChemNet > CAS > 25194-67-6 6-phenoxy-3-pyridinamine
25194-67-6 6-phenoxy-3-pyridinamine
| product Name |
6-phenoxy-3-pyridinamine |
| CAS No |
25194-67-6 |
| Synonyms |
Pyridine, 5-amino-2-phenoxy-; 3-Amino-6-phenoxypyridine; 4-22-00-05575 (Beilstein Handbook Reference); 5-Amino-2-phenoxypyridine; BRN 0140834; 6-phenoxypyridin-3-amine |
| Molecular Formula |
C11H10N2O |
| Molecular Weight |
186.2099 |
| InChI |
InChI=1/C11H10N2O/c12-9-6-7-11(13-8-9)14-10-4-2-1-3-5-10/h1-8H,12H2 |
| Molecular Structure |
|
| Density |
1.197g/cm3 |
| Boiling point |
365.3°C at 760 mmHg |
| Refractive index |
1.625 |
| Flash point |
174.7°C |
| Vapour Pressur |
1.59E-05mmHg at 25°C |
| Hazard Symbols |
 Xn:Harmful;
|
| Risk Codes |
R22:Harmful if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
