ChemNet > CAS > 25260-60-0 cis-1,4-diacetoxy-2-butene
25260-60-0 cis-1,4-diacetoxy-2-butene
| product Name |
cis-1,4-diacetoxy-2-butene |
| CAS No |
25260-60-0 |
| Synonyms |
cis-2-Butene-1,4-diol diacetate; (2Z)-but-2-ene-1,4-diyl diacetate |
| Molecular Formula |
C8H12O4 |
| Molecular Weight |
172.1785 |
| InChI |
InChI=1/C8H12O4/c1-7(9)11-5-3-4-6-12-8(2)10/h3-4H,5-6H2,1-2H3/b4-3- |
| Molecular Structure |
|
| Density |
1.068g/cm3 |
| Boiling point |
230.905°C at 760 mmHg |
| Refractive index |
1.443 |
| Flash point |
108.29°C |
| Vapour Pressur |
0.064mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
