CAS No: 25265-76-3, Chemical Name: benzene-1,2-diamine,benzene-1,3-diamine,benzene-1,4-diamine
the physical and chemical property of 25265-76-3, benzene-1,2-diamine,benzene-1,3-diamine,benzene-1,4-diamine is provided by ChemNet.com
ChemNet > CAS > 25265-76-3 benzene-1,2-diamine,benzene-1,3-diamine,benzene-1,4-diamine
25265-76-3 benzene-1,2-diamine,benzene-1,3-diamine,benzene-1,4-diamine
| product Name |
benzene-1,2-diamine,benzene-1,3-diamine,benzene-1,4-diamine |
| Synonyms |
1,2-Benzenediamine,1,2-Benzènediamine,1,2-Benzoldiamin; 1,2-Phenylene diamine,Benzol-1,2-diamin,benzene-1,2-diamine; Ortho Phenylene Diamine |
| Molecular Formula |
C6H8N2 |
| Molecular Weight |
108.1411 |
| InChI |
InChI=1/C6H8N2/c7-5-3-1-2-4-6(5)8/h1-4H,7-8H2 |
| CAS Registry Number |
25265-76-3 |
| EINECS |
202-430-6 |
| Molecular Structure |
|
| Density |
1.15g/cm3 |
| Boiling point |
257°C at 760 mmHg |
| Refractive index |
1.66 |
| Flash point |
124.9°C |
| Vapour Pressur |
0.0149mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|
