ChemNet > CAS > 2527-99-3 Methyl 5-bromo-2-furoate
2527-99-3 Methyl 5-bromo-2-furoate
| product Name |
Methyl 5-bromo-2-furoate |
| CAS No |
2527-99-3 |
| Synonyms |
methyl 5-bromofuran-2-carboxylate |
| Molecular Formula |
C6H5BrO3 |
| Molecular Weight |
205.0061 |
| InChI |
InChI=1/C6H5BrO3/c1-9-6(8)4-2-3-5(7)10-4/h2-3H,1H3 |
| Molecular Structure |
|
| Density |
1.623g/cm3 |
| Melting point |
62-65℃ |
| Boiling point |
226.3°C at 760 mmHg |
| Refractive index |
1.513 |
| Flash point |
90.7°C |
| Vapour Pressur |
0.0824mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
