ChemNet > CAS > 25309-65-3 4-Ethylbenzonitrile
25309-65-3 4-Ethylbenzonitrile
| product Name |
4-Ethylbenzonitrile |
| CAS No |
25309-65-3 |
| Synonyms |
Benzonitrile, 4-ethyl- |
| Molecular Formula |
C9H9N |
| Molecular Weight |
131.1745 |
| InChI |
InChI=1/C9H9N/c1-2-8-3-5-9(7-10)6-4-8/h3-6H,2H2,1H3 |
| EINECS |
246-811-5 |
| Molecular Structure |
|
| Density |
0.98g/cm3 |
| Boiling point |
226.3°C at 760 mmHg |
| Refractive index |
1.523 |
| Flash point |
90.5°C |
| Vapour Pressur |
0.0824mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
