25309-65-3 4-Ethylbenzonitrile
product Name |
4-Ethylbenzonitrile |
CAS No |
25309-65-3 |
Synonyms |
Benzonitrile, 4-ethyl- |
Molecular Formula |
C9H9N |
Molecular Weight |
131.1745 |
InChI |
InChI=1/C9H9N/c1-2-8-3-5-9(7-10)6-4-8/h3-6H,2H2,1H3 |
EINECS |
246-811-5 |
Molecular Structure |
|
Density |
0.98g/cm3 |
Boiling point |
226.3°C at 760 mmHg |
Refractive index |
1.523 |
Flash point |
90.5°C |
Vapour Pressur |
0.0824mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|