ChemNet > CAS > 25333-24-8 Methyl 3-Benzoylpropionate
25333-24-8 Methyl 3-Benzoylpropionate
| product Name |
Methyl 3-Benzoylpropionate |
| CAS No |
25333-24-8 |
| Synonyms |
3-Benzoylpropionic acid methyl ester; methyl 4-oxo-4-phenylbutanoate |
| Molecular Formula |
C11H12O3 |
| Molecular Weight |
192.2112 |
| InChI |
InChI=1/C11H12O3/c1-14-11(13)8-7-10(12)9-5-3-2-4-6-9/h2-6H,7-8H2,1H3 |
| Molecular Structure |
|
| Density |
1.104g/cm3 |
| Boiling point |
307.8°C at 760 mmHg |
| Refractive index |
1.509 |
| Flash point |
134.6°C |
| Vapour Pressur |
0.000707mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
