ChemNet > CAS > 25343-30-0 1-(2,6-Diethylphenyl)-thiourea
25343-30-0 1-(2,6-Diethylphenyl)-thiourea
| product Name |
1-(2,6-Diethylphenyl)-thiourea |
| CAS No |
25343-30-0 |
| Synonyms |
2,6-Diethylphenylthiourea |
| Molecular Formula |
C11H16N2S |
| Molecular Weight |
208.3231 |
| InChI |
InChI=1/C11H16N2S/c1-3-8-6-5-7-9(4-2)10(8)13-11(12)14/h5-7H,3-4H2,1-2H3,(H3,12,13,14) |
| Molecular Structure |
|
| Density |
1.137g/cm3 |
| Boiling point |
319.3°C at 760 mmHg |
| Refractive index |
1.637 |
| Flash point |
146.9°C |
| Vapour Pressur |
0.000341mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R25:Toxic if swallowed.;
|
| Safety Description |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
