ChemNet > CAS > 25354-97-6 2-hexyldecanoic acid
25354-97-6 2-hexyldecanoic acid
| product Name |
2-hexyldecanoic acid |
| CAS No |
25354-97-6 |
| Synonyms |
Hexyldecanoicacid; 2-n-Hexyldecanoic acid |
| Molecular Formula |
C16H32O2 |
| Molecular Weight |
256.4241 |
| InChI |
InChI=1/C16H32O2/c1-3-5-7-9-10-12-14-15(16(17)18)13-11-8-6-4-2/h15H,3-14H2,1-2H3,(H,17,18) |
| EINECS |
246-885-9 |
| Molecular Structure |
|
| Density |
0.891g/cm3 |
| Melting point |
18℃ |
| Boiling point |
371°C at 760 mmHg |
| Refractive index |
1.452 |
| Flash point |
207.1°C |
| Vapour Pressur |
1.6E-06mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
