ChemNet > CAS > 25369-78-2 5-Chloro-2-mercaptobenzimidazole
25369-78-2 5-Chloro-2-mercaptobenzimidazole
| product Name |
5-Chloro-2-mercaptobenzimidazole |
| Synonyms |
5-Chlorobenzimidazole-2-thiol; 6-chloro-1H-benzimidazole-2-thiol |
| Molecular Formula |
C7H5ClN2S |
| Molecular Weight |
184.646 |
| InChI |
InChI=1/C7H5ClN2S/c8-4-1-2-5-6(3-4)10-7(11)9-5/h1-3H,(H2,9,10,11) |
| CAS Registry Number |
25369-78-2 |
| EINECS |
246-903-5 |
| Molecular Structure |
|
| Density |
1.54g/cm3 |
| Melting point |
290-292℃ |
| Boiling point |
300.7°C at 760 mmHg |
| Refractive index |
1.75 |
| Flash point |
135.6°C |
| Vapour Pressur |
0.0011mmHg at 25°C |
| Hazard Symbols |
 T:Toxic;
|
| Risk Codes |
R25:Toxic if swallowed.;
|
| Safety Description |
S28A:After contact with skin, wash immediately with plenty of water.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
| MSDS |
5-Chloro-2-mercaptobenzimidazole Material Safety Data Sheet
|
|
