ChemNet > CAS > 25493-13-4 p-Xylene-alpha,alpha,alpha,alpha',alpha',alpha'-d6
25493-13-4 p-Xylene-alpha,alpha,alpha,alpha',alpha',alpha'-d6
| product Name |
p-Xylene-alpha,alpha,alpha,alpha',alpha',alpha'-d6 |
| CAS No |
25493-13-4 |
| Synonyms |
p-Xylene-alpha,alpha-d6,98 atom % D; P-xylene-alpha,alpha,alpha,alpha,alpha; 1,4-bis[(~2~H_3_)methyl]benzene |
| Molecular Formula |
C8H4D6 |
| Molecular Weight |
112.202 |
| InChI |
InChI=1/C8H10/c1-7-3-5-8(2)6-4-7/h3-6H,1-2H3/i1D3,2D3 |
| EINECS |
247-033-9 |
| Molecular Structure |
|
| Density |
0.919g/cm3 |
| Melting point |
13℃ |
| Boiling point |
139.6°C at 760 mmHg |
| Refractive index |
1.5 |
| Flash point |
27.2°C |
| Vapour Pressur |
7.94mmHg at 25°C |
| Hazard Symbols |
 Xn:Harmful;
|
| Risk Codes |
R10:Flammable.;
R20/21:Harmful by inhalation and in contact with skin.;
R38:Irritating to skin.;
|
| Safety Description |
S25:Avoid contact with eyes.;
|
|
