25524-95-2 Jasminlactone
| product Name |
Jasminlactone |
| CAS No |
25524-95-2 |
| Synonyms |
5-hydroxy-7-decenoic acid delta lactone; 6-[(2Z)-pent-2-en-1-yl]tetrahydro-2H-pyran-2-one; 6-[(2E)-pent-2-en-1-yl]tetrahydro-2H-pyran-2-one |
| Molecular Formula |
C10H16O2 |
| Molecular Weight |
168.2328 |
| InChI |
InChI=1/C10H16O2/c1-2-3-4-6-9-7-5-8-10(11)12-9/h3-4,9H,2,5-8H2,1H3/b4-3+ |
| EINECS |
247-074-2 |
| Molecular Structure |
|
| Density |
0.962g/cm3 |
| Boiling point |
281.5°C at 760 mmHg |
| Refractive index |
1.462 |
| Flash point |
113.1°C |
| Vapour Pressur |
0.00355mmHg at 25°C |
|