ChemNet > CAS > 2555-05-7 3-Methyl-2-pyrrolidinone
2555-05-7 3-Methyl-2-pyrrolidinone
| product Name |
3-Methyl-2-pyrrolidinone |
| CAS No |
2555-05-7 |
| Synonyms |
alpha-Methylbutyrolactam~3-Methyl-2-pyrrolidone; 3-methylpyrrolidin-2-one |
| Molecular Formula |
C5H9NO |
| Molecular Weight |
99.1311 |
| InChI |
InChI=1/C5H9NO/c1-4-2-3-6-5(4)7/h4H,2-3H2,1H3,(H,6,7) |
| EINECS |
219-865-2 |
| Molecular Structure |
|
| Density |
0.979g/cm3 |
| Boiling point |
240.5°C at 760 mmHg |
| Refractive index |
1.439 |
| Flash point |
127.5°C |
| Vapour Pressur |
0.0377mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
