ChemNet > CAS > 25570-02-9 3,3',5,5'-Tetramethylbiphenyl
25570-02-9 3,3',5,5'-Tetramethylbiphenyl
| product Name |
3,3',5,5'-Tetramethylbiphenyl |
| CAS No |
25570-02-9 |
| Molecular Formula |
C16H18 |
| Molecular Weight |
210.3141 |
| InChI |
InChI=1/C16H18/c1-11-5-12(2)8-15(7-11)16-9-13(3)6-14(4)10-16/h5-10H,1-4H3 |
| Molecular Structure |
|
| Density |
0.956g/cm3 |
| Boiling point |
300.9°C at 760 mmHg |
| Refractive index |
1.551 |
| Flash point |
138.7°C |
| Vapour Pressur |
0.00195mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
