ChemNet > CAS > 255724-71-1 5-Fluoro-2-iodoaniline
255724-71-1 5-Fluoro-2-iodoaniline
| product Name |
5-Fluoro-2-iodoaniline |
| CAS No |
255724-71-1 |
| Molecular Formula |
C6H5FIN |
| Molecular Weight |
237.0135 |
| InChI |
InChI=1/C6H5FIN/c7-4-1-2-5(8)6(9)3-4/h1-3H,9H2 |
| Molecular Structure |
|
| Density |
2.008g/cm3 |
| Boiling point |
258.2°C at 760 mmHg |
| Refractive index |
1.656 |
| Flash point |
110°C |
| Vapour Pressur |
0.0139mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Safety Description |
S28:After contact with skin, wash immediately with plenty of ...;
S36/37:Wear suitable protective clothing and gloves.;
|
|
