ChemNet > CAS > 2563-07-7 2-Ethoxy-p-cresol
2563-07-7 2-Ethoxy-p-cresol
| product Name |
2-Ethoxy-p-cresol |
| CAS No |
2563-07-7 |
| Synonyms |
2-Ethoxy-p-cresol (OH=1); 2-Ethoxy-4-methylphenol |
| Molecular Formula |
C9H12O2 |
| Molecular Weight |
152.1904 |
| InChI |
InChI=1/C9H12O2/c1-3-11-9-6-7(2)4-5-8(9)10/h4-6,10H,3H2,1-2H3 |
| Molecular Structure |
|
| Density |
1.052g/cm3 |
| Boiling point |
243.7°C at 760 mmHg |
| Refractive index |
1.524 |
| Flash point |
105°C |
| Vapour Pressur |
0.0203mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
