ChemNet > CAS > 25637-84-7 diolein (C18:1,(cis)-9)
25637-84-7 diolein (C18:1,(cis)-9)
| product Name |
diolein (C18:1,(cis)-9) |
| CAS No |
25637-84-7 |
| Synonyms |
Glyceryl dioleate; 9-Octadecenoic acid, diester with 1,2,3-propanetriol; Diolein; 9-Octadecenoic acid (9Z)-, diester with 1,2,3-propanetriol; 9-Octadecenoic acid (Z)-, diester with 1,2,3-propanetriol; Dioleic acid, diester with glycerol; 2-hydroxypropane-1,3-diyl bisoctadec-9-enoate; 3-hydroxypropane-1,2-diyl (9Z,9'Z)bis-octadec-9-enoate |
| Molecular Formula |
C39H72O5 |
| Molecular Weight |
620.986 |
| InChI |
InChI=1/C39H72O5/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-38(41)43-36-37(35-40)44-39(42)34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h17-20,37,40H,3-16,21-36H2,1-2H3/b19-17-,20-18- |
| EINECS |
247-144-2 |
| Molecular Structure |
|
| Density |
0.934g/cm3 |
| Boiling point |
670.8°C at 760 mmHg |
| Refractive index |
1.477 |
| Flash point |
186.3°C |
| Vapour Pressur |
7.31E-21mmHg at 25°C |
|