ChemNet > CAS > 2564-95-6 NN-Dimethylsuccinamic Acid
2564-95-6 NN-Dimethylsuccinamic Acid
| product Name |
NN-Dimethylsuccinamic Acid |
| CAS No |
2564-95-6 |
| Synonyms |
N,N-Dimethylsuccinamic acid; Butanedioic acid mono(N,N-dimethylamide); 4-(dimethylamino)-4-oxobutanoic acid; 4-(dimethylamino)-4-oxobutanoate |
| Molecular Formula |
C6H10NO3 |
| Molecular Weight |
144.149 |
| InChI |
InChI=1/C6H11NO3/c1-7(2)5(8)3-4-6(9)10/h3-4H2,1-2H3,(H,9,10)/p-1 |
| Molecular Structure |
|
| Boiling point |
297.5°C at 760 mmHg |
| Flash point |
133.7°C |
| Vapour Pressur |
0.000321mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
