ChemNet > CAS > 2567-29-5 Bromoethylbiphenyl
2567-29-5 Bromoethylbiphenyl
| product Name |
Bromoethylbiphenyl |
| CAS No |
2567-29-5 |
| Synonyms |
4-Bromoethylbiphenyl; 4-(Bromomethyl)biphenyl; 4-Phenylbenzyl bromide |
| Molecular Formula |
C13H11Br |
| Molecular Weight |
247.1304 |
| InChI |
InChI=1/C13H11Br/c14-10-11-6-8-13(9-7-11)12-4-2-1-3-5-12/h1-9H,10H2 |
| Molecular Structure |
|
| Density |
1.341g/cm3 |
| Melting point |
86℃ |
| Boiling point |
333.4°C at 760 mmHg |
| Refractive index |
1.605 |
| Flash point |
161.3°C |
| Vapour Pressur |
0.000266mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
