2571-52-0 Mesitonitrile
product Name |
Mesitonitrile |
CAS No |
2571-52-0 |
Synonyms |
2,4,6-Trimethylbenzonitrile; Cyanomesitylene |
Molecular Formula |
C10H11N |
Molecular Weight |
145.201 |
InChI |
InChI=1/C10H11N/c1-7-4-8(2)10(6-11)9(3)5-7/h4-5H,1-3H3 |
Molecular Structure |
|
Density |
0.97g/cm3 |
Boiling point |
260.3°C at 760 mmHg |
Refractive index |
1.521 |
Flash point |
111.3°C |
Vapour Pressur |
0.0123mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|