ChemNet > CAS > 2586-62-1 1-Bromo-2-methylnaphthalene
2586-62-1 1-Bromo-2-methylnaphthalene
| product Name |
1-Bromo-2-methylnaphthalene |
| CAS No |
2586-62-1 |
| Synonyms |
1-Bromo-2-methylnaphtalene |
| Molecular Formula |
C11H9Br |
| Molecular Weight |
221.0932 |
| InChI |
InChI=1/C11H9Br/c1-8-6-7-9-4-2-3-5-10(9)11(8)12/h2-7H,1H3 |
| EINECS |
219-966-1 |
| Molecular Structure |
|
| Density |
1.417g/cm3 |
| Boiling point |
300.9°C at 760 mmHg |
| Refractive index |
1.645 |
| Flash point |
137.4°C |
| Vapour Pressur |
0.00195mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
