ChemNet > CAS > 26125-61-1 poly(N,N'-(1,4-phenylene)terephthalamide)
26125-61-1 poly(N,N'-(1,4-phenylene)terephthalamide)
| product Name |
poly(N,N'-(1,4-phenylene)terephthalamide) |
| CAS No |
26125-61-1 |
| Synonyms |
para-Aramid fibrils; para-Phenylenediamine terephthalic acid chloride copolymer; 1,4-Benzenedicarbonyl dichloride, polymer with 1,4-benzenediamine; 1,4-Benzenedicaronyl dichloride, polymer with 1,4-benzenediamine; benzene-1,4-dicarbonyl dichloride - benzene-1,4-diamine (1:1) |
| Molecular Formula |
C14H12Cl2N2O2 |
| Molecular Weight |
311.1633 |
| InChI |
InChI=1/C8H4Cl2O2.C6H8N2/c9-7(11)5-1-2-6(4-3-5)8(10)12;7-5-1-2-6(8)4-3-5/h1-4H;1-4H,7-8H2 |
| Molecular Structure |
|
| Boiling point |
266°C at 760 mmHg |
| Flash point |
143.1°C |
| Vapour Pressur |
0.00887mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|
