ChemNet > CAS > 261762-35-0 5-Bromo-2,3-difluoroanisole
261762-35-0 5-Bromo-2,3-difluoroanisole
| product Name |
5-Bromo-2,3-difluoroanisole |
| CAS No |
261762-35-0 |
| Synonyms |
2.3-Difluoro-5-Bromoanisole; 5-bromo-1,2-difluoro-3-methoxybenzene |
| Molecular Formula |
C7H5BrF2O |
| Molecular Weight |
223.0148 |
| InChI |
InChI=1/C7H5BrF2O/c1-11-6-3-4(8)2-5(9)7(6)10/h2-3H,1H3 |
| Molecular Structure |
|
| Density |
1.615g/cm3 |
| Boiling point |
193.7°C at 760 mmHg |
| Refractive index |
1.5 |
| Flash point |
84.6°C |
| Vapour Pressur |
0.639mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
