ChemNet > CAS > 261762-42-9 2-Chloro-3,6-difluorobenzoyl chloride
261762-42-9 2-Chloro-3,6-difluorobenzoyl chloride
| product Name |
2-Chloro-3,6-difluorobenzoyl chloride |
| CAS No |
261762-42-9 |
| Molecular Formula |
C7H2Cl2F2O |
| Molecular Weight |
210.993 |
| InChI |
InChI=1/C7H2Cl2F2O/c8-6-4(11)2-1-3(10)5(6)7(9)12/h1-2H |
| Molecular Structure |
|
| Density |
1.548g/cm3 |
| Boiling point |
218.8°C at 760 mmHg |
| Refractive index |
1.519 |
| Flash point |
86.1°C |
| Vapour Pressur |
0.123mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R34:Causes burns.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
