ChemNet > CAS > 261762-46-3 3-Chloro-2,6-difluorobenzylamine
261762-46-3 3-Chloro-2,6-difluorobenzylamine
| product Name |
3-Chloro-2,6-difluorobenzylamine |
| CAS No |
261762-46-3 |
| Synonyms |
1-(3-chloro-2,6-difluorophenyl)methanamine |
| Molecular Formula |
C7H6ClF2N |
| Molecular Weight |
177.579 |
| InChI |
InChI=1/C7H6ClF2N/c8-5-1-2-6(9)4(3-11)7(5)10/h1-2H,3,11H2 |
| Molecular Structure |
|
| Density |
1.368g/cm3 |
| Boiling point |
212°C at 760 mmHg |
| Refractive index |
1.522 |
| Flash point |
82°C |
| Vapour Pressur |
0.177mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R34:Causes burns.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
