ChemNet > CAS > 261763-37-5 2,3-Difluoro-4-methylbenzoic acid
261763-37-5 2,3-Difluoro-4-methylbenzoic acid
| product Name |
2,3-Difluoro-4-methylbenzoic acid |
| CAS No |
261763-37-5 |
| Synonyms |
2,3-Difluoro-p-toluic acid |
| Molecular Formula |
C8H6F2O2 |
| Molecular Weight |
172.1288 |
| InChI |
InChI=1/C8H6F2O2/c1-4-2-3-5(8(11)12)7(10)6(4)9/h2-3H,1H3,(H,11,12) |
| Molecular Structure |
|
| Density |
1.359g/cm3 |
| Boiling point |
274°C at 760 mmHg |
| Refractive index |
1.511 |
| Flash point |
119.5°C |
| Vapour Pressur |
0.0027mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
