ChemNet > CAS > 26260-02-6 2-Iodobenzaldehyde
26260-02-6 2-Iodobenzaldehyde
| product Name |
2-Iodobenzaldehyde |
| CAS No |
26260-02-6 |
| Synonyms |
Benzaldehyde, 2-iodo- |
| Molecular Formula |
C7H5IO |
| Molecular Weight |
232.0185 |
| InChI |
InChI=1/C7H5IO/c8-7-4-2-1-3-6(7)5-9/h1-5H |
| Molecular Structure |
|
| Density |
1.883g/cm3 |
| Melting point |
36-39℃ |
| Boiling point |
266.3°C at 760 mmHg |
| Refractive index |
1.668 |
| Flash point |
114.8°C |
| Vapour Pressur |
0.00873mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
| MSDS |
Material Safety Data Sheet
|
|
