2628-17-3 4-Vinylphenol
product Name |
4-Vinylphenol |
CAS No |
2628-17-3 |
Synonyms |
4-Hydroxystyrene; p-Vinylphenol; 4'-Hydroxystyrene |
Molecular Formula |
C8H8O |
Molecular Weight |
120.15 |
InChI |
InChI=1/C8H8O/c1-2-7-3-5-8(9)6-4-7/h2-6,9H,1H2 |
EINECS |
220-103-6 |
Molecular Structure |
|
Melting point |
73℃ |
Hazard Symbols |
|
Risk Codes |
R36/38:Irritating to eyes and skin.;
|
Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|