ChemNet > CAS > 2631-77-8 3,5-diiodosalicylaldehyde
2631-77-8 3,5-diiodosalicylaldehyde
| product Name |
3,5-diiodosalicylaldehyde |
| CAS No |
2631-77-8 |
| Synonyms |
3,5-Diiodo-2-hydroxybenzaldehyde~2-Hydroxy-3,5-diiodobenzaldehyde; 2-hydroxy-3,5-diiodobenzaldehyde |
| Molecular Formula |
C7H4I2O2 |
| Molecular Weight |
373.9144 |
| InChI |
InChI=1/C7H4I2O2/c8-5-1-4(3-10)7(11)6(9)2-5/h1-3,11H |
| EINECS |
220-117-2 |
| Molecular Structure |
|
| Density |
2.602g/cm3 |
| Melting point |
109-110℃ |
| Boiling point |
304.6°C at 760 mmHg |
| Refractive index |
1.787 |
| Flash point |
138°C |
| Vapour Pressur |
0.000481mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
