ChemNet > CAS > 26315-61-7 (1R)-(-)-Menthyl glyoxylate hydrate
26315-61-7 (1R)-(-)-Menthyl glyoxylate hydrate
| product Name |
(1R)-(-)-Menthyl glyoxylate hydrate |
| CAS No |
26315-61-7 |
| Synonyms |
Glyoxylic acid (1R)-menthyl ester hydrate; (1R,2S,5R)-5-methyl-2-(1-methylethyl)cyclohexyl oxoacetate |
| Molecular Formula |
C12H20O3 |
| Molecular Weight |
212.2854 |
| InChI |
InChI=1/C12H20O3/c1-8(2)10-5-4-9(3)6-11(10)15-12(14)7-13/h7-11H,4-6H2,1-3H3/t9-,10+,11-/m1/s1 |
| Molecular Structure |
|
| Density |
1g/cm3 |
| Boiling point |
282°C at 760 mmHg |
| Refractive index |
1.458 |
| Flash point |
116.5°C |
| Vapour Pressur |
0.00344mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R51/53:Toxic to aquatic organisms, may cause long-term adverse effects in the aquatic environment.;
|
| Safety Description |
S61:Avoid release to the environment. Refer to special instructions / Safety data sheets.;
|
|
