ChemNet > CAS > 26385-07-9 N-(2-Chloroethyl)benzamide
26385-07-9 N-(2-Chloroethyl)benzamide
| product Name |
N-(2-Chloroethyl)benzamide |
| CAS No |
26385-07-9 |
| Molecular Formula |
C9H10ClNO |
| Molecular Weight |
183.6348 |
| InChI |
InChI=1/C9H10ClNO/c10-6-7-11-9(12)8-4-2-1-3-5-8/h1-5H,6-7H2,(H,11,12) |
| EINECS |
247-641-4 |
| Molecular Structure |
|
| Density |
1.164g/cm3 |
| Melting point |
102-106℃ |
| Boiling point |
366.4°C at 760 mmHg |
| Refractive index |
1.538 |
| Flash point |
175.4°C |
| Vapour Pressur |
1.47E-05mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
