ChemNet > CAS > 2642-98-0 6-Aminochrysene
2642-98-0 6-Aminochrysene
| product Name |
6-Aminochrysene |
| Synonyms |
6-Chrysenamine; chrysen-6-ylamine; chrysen-6-amine |
| Molecular Formula |
C18H13N |
| Molecular Weight |
243.3025 |
| InChI |
InChI=1/C18H13N/c19-18-11-17-13-6-2-1-5-12(13)9-10-15(17)14-7-3-4-8-16(14)18/h1-11H,19H2 |
| CAS Registry Number |
2642-98-0 |
| EINECS |
220-149-7 |
| Molecular Structure |
|
| Density |
1.253g/cm3 |
| Melting point |
206-211℃ |
| Boiling point |
501.2°C at 760 mmHg |
| Refractive index |
1.813 |
| Flash point |
286.9°C |
| Vapour Pressur |
3.56E-10mmHg at 25°C |
| Hazard Symbols |
 Xn:Harmful;
|
| Risk Codes |
|
| Safety Description |
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
| MSDS |
6-Aminochrysene Material Safety Data Sheet
|
|
