ChemNet > CAS > 26544-38-7 2-Dodecen-1-ylsuccinic anhydride, mixtureof isomers
26544-38-7 2-Dodecen-1-ylsuccinic anhydride, mixtureof isomers
| product Name |
2-Dodecen-1-ylsuccinic anhydride, mixtureof isomers |
| CAS No |
26544-38-7 |
| Molecular Formula |
C16H26O3 |
| Molecular Weight |
266.3758 |
| InChI |
InChI=1/C16H26O3/c1-10(2)6-11(3)7-12(4)8-13(5)14-9-15(17)19-16(14)18/h8,10-12,14H,6-7,9H2,1-5H3/b13-8+ |
| EINECS |
247-781-6 |
| Molecular Structure |
|
| Density |
0.999g/cm3 |
| Boiling point |
370.2°C at 760 mmHg |
| Refractive index |
1.479 |
| Flash point |
163.2°C |
| Vapour Pressur |
1.12E-05mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
