ChemNet > CAS > 2657-25-2 4'-Hydroxychalcone
2657-25-2 4'-Hydroxychalcone
| product Name |
4'-Hydroxychalcone |
| CAS No |
2657-25-2 |
| Synonyms |
Benzylidene-(4-hydroxyacetophenone); 1-(4-hydroxyphenyl)-3-phenylprop-2-en-1-one; (2E)-1-(4-hydroxyphenyl)-3-phenylprop-2-en-1-one |
| Molecular Formula |
C15H12O2 |
| Molecular Weight |
224.2546 |
| InChI |
InChI=1/C15H12O2/c16-14-9-7-13(8-10-14)15(17)11-6-12-4-2-1-3-5-12/h1-11,16H/b11-6+ |
| Molecular Structure |
|
| Density |
1.191g/cm3 |
| Boiling point |
419.6°C at 760 mmHg |
| Refractive index |
1.653 |
| Flash point |
179.1°C |
| Vapour Pressur |
1.23E-07mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
| MSDS |
Material Safety Data Sheet
|
|
