ChemNet > CAS > 26590-20-5 Methyltetrahydrophthalic anhydride
26590-20-5 Methyltetrahydrophthalic anhydride
| product Name |
Methyltetrahydrophthalic anhydride |
| CAS No |
26590-20-5 |
| Synonyms |
MeTHPA; thyltetrahydrophthalic anhydride; Methylcyclohexenedicarboxylicanhydride |
| Molecular Formula |
C9H10O3 |
| Molecular Weight |
166.1766 |
| InChI |
InChI=1/C18H22O7/c1-17(9-5-3-7-11(17)13(19)20)15(23)25-16(24)18(2)10-6-4-8-12(18)14(21)22/h3-6,11-12H,7-10H2,1-2H3,(H,19,20)(H,21,22) |
| EINECS |
247-830-1 |
| Molecular Structure |
|
| Refractive index |
1.545 |
|
Featured China Suppliers
| Description |
Product name: ZL-JS101 CASNO: 11070-44-3 Chemical name: Methyl Tetrahydrophthalic Anhydride (MTHPA) Molecular formula: C9H10O3 Quality index | Item | Index | | Appearance | Light yellow transparent liquid | | Purity (%) | ¡Ý98.0 | | Color (platinum cobalt) | ¡Ü150# | | Color (Gardner) | ¡Ü2 | | Acid value (mgK0H/g) | 660.0-685.0 | | Anhydride content (%) | ¡Ý40.5 | | Viscosity (mps. s 25¡æ) | ¡Ü50 | | Density... |
| Contact |
Mr. Ren |
| Telephone |
+86-530-2332333 |
| Email |
sales@sdzlchem.com |
| Address |
East of the road, 300 meters south of the intersection of Linze Road and Changcheng Street, Juancheng County, Heze City, Shandong Province, China |
| Description |
ÎÞ±êÌâÎĵµ Item | SHY¡ª9601 | SHY¡ª9602 | SHY-9603 | Appearance | light yellow transparent liquid | colorless transparent liquid | <...
| Contact |
Hong Pan |
| Telephone |
+86-573-83919206 |
| Email |
alice.pan@doublehorse.com/jialei.shi@doublehorse.com |
| Address |
Bujiao Gonglu, Daqiao Town, Jiaxing, Zhejiang, China |
| Packing |
220KG |
| Telephone |
86-573-82612221 82612743 82612149 83286377 |
| Email |
sales@nanhuchem.com |
| Address |
Mingxing Rd, Daqiao Town, Jiaxing City Zhejiang |
| Telephone |
+86-571-88086639 |
| Email |
info@star-chemicals.com |
| Address |
No. 810 Qinggong Building, No. 8 Wensan Road, Hangzhou, China |
| Telephone |
+86-21-64020796 |
| Email |
punachem@126.com |
| Address |
Pudong District, Shanghai, China |
| |